About potassium;hydride;N-methyl-N-(pyridin-2-ylmethyl)thiophene-2-carboxamide
potassium;hydride;N-methyl-N-(pyridin-2-ylmethyl)thiophene-2-carboxamide (PubChem CID 173152580) has the molecular formula C12H13KN2OS
and a molecular weight of 272.41 g/mol. Its IUPAC name is potassium;hydride;N-methyl-N-(pyridin-2-ylmethyl)thiophene-2-carboxamide.
Molecular Properties
| Compound Name | potassium;hydride;N-methyl-N-(pyridin-2-ylmethyl)thiophene-2-carboxamide |
| PubChem CID | 173152580 |
| Molecular Formula | C12H13KN2OS |
| Molecular Weight | 272.41 g/mol |
| Exact Mass | 272.04 |
| IUPAC Name | potassium;hydride;N-methyl-N-(pyridin-2-ylmethyl)thiophene-2-carboxamide |
| SMILES | CN(Cc1ccccn1)C(=O)c1cccs1.[H-].[K+] |
| InChI | InChI=1S/C12H12N2OS.K.H/c1-14(9-10-5-2-3-7-13-10)12(15)11-6-4-8-16-11;;/h2-8H,9H2,1H3;;/q;+1;-1 |
| InChIKey | QGYMWNSVVSBEAE-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.41 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze potassium;hydride;N-methyl-N-(pyridin-2-ylmethyl)thiophene-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium;hydride;N-methyl-N-(pyridin-2-ylmethyl)thiophene-2-carboxamide?
The IUPAC name of potassium;hydride;N-methyl-N-(pyridin-2-ylmethyl)thiophene-2-carboxamide (CID 173152580) is potassium;hydride;N-methyl-N-(pyridin-2-ylmethyl)thiophene-2-carboxamide.
What is the SMILES notation for potassium;hydride;N-methyl-N-(pyridin-2-ylmethyl)thiophene-2-carboxamide?
The canonical SMILES for potassium;hydride;N-methyl-N-(pyridin-2-ylmethyl)thiophene-2-carboxamide is CN(Cc1ccccn1)C(=O)c1cccs1.[H-].[K+].
What is the InChIKey of potassium;hydride;N-methyl-N-(pyridin-2-ylmethyl)thiophene-2-carboxamide?
The InChIKey is QGYMWNSVVSBEAE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12N2OS.K.H/c1-14(9-10-5-2-3-7-13-10)12(15)11-6-4-8-16-11;;/h2-8H,9H2,1H3;;/q;+1;-1.
What are the key properties of potassium;hydride;N-methyl-N-(pyridin-2-ylmethyl)thiophene-2-carboxamide?
potassium;hydride;N-methyl-N-(pyridin-2-ylmethyl)thiophene-2-carboxamide has a molecular weight of 272.41 g/mol, XLogP of -0.47, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for potassium;hydride;N-methyl-N-(pyridin-2-ylmethyl)thiophene-2-carboxamide is sourced from PubChem (CID 173152580), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).