C20H18ClFN2O2S — CID 8503964
3-chloro-N-[4-(diethylcarbamoyl)phenyl]-6-fluoro-1-benzothiophene-2-carboxamide (PubChem CID 8503964) has the molecular formula C20H18ClFN2O2S and a molecular weight of 404.89 g/mol. Its IUPAC name is 3-chloro-N-[4-(diethylcarbamoyl)phenyl]-6-fluoro-1-benzothiophene-2-carboxamide.
| Compound Name | 3-chloro-N-[4-(diethylcarbamoyl)phenyl]-6-fluoro-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 8503964 |
| Molecular Formula | C20H18ClFN2O2S |
| Molecular Weight | 404.89 g/mol |
| Exact Mass | 404.08 |
| IUPAC Name | 3-chloro-N-[4-(diethylcarbamoyl)phenyl]-6-fluoro-1-benzothiophene-2-carboxamide |
| SMILES | CCN(CC)C(=O)c1ccc(NC(=O)c2sc3cc(F)ccc3c2Cl)cc1 |
| InChI | InChI=1S/C20H18ClFN2O2S/c1-3-24(4-2)20(26)12-5-8-14(9-6-12)23-19(25)18-17(21)15-10-7-13(22)11-16(15)27-18/h5-11H,3-4H2,1-2H3,(H,23,25) |
| InChIKey | XDRBHCTZLQHROC-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.89 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |