C23H16ClFN2O2S — CID 46475379
3-chloro-6-fluoro-N-[[3-(phenylcarbamoyl)phenyl]methyl]-1-benzothiophene-2-carboxamide (PubChem CID 46475379) has the molecular formula C23H16ClFN2O2S and a molecular weight of 438.91 g/mol. Its IUPAC name is 3-chloro-6-fluoro-N-[[3-(phenylcarbamoyl)phenyl]methyl]-1-benzothiophene-2-carboxamide.
| Compound Name | 3-chloro-6-fluoro-N-[[3-(phenylcarbamoyl)phenyl]methyl]-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 46475379 |
| Molecular Formula | C23H16ClFN2O2S |
| Molecular Weight | 438.91 g/mol |
| Exact Mass | 438.06 |
| IUPAC Name | 3-chloro-6-fluoro-N-[[3-(phenylcarbamoyl)phenyl]methyl]-1-benzothiophene-2-carboxamide |
| SMILES | O=C(Nc1ccccc1)c1cccc(CNC(=O)c2sc3cc(F)ccc3c2Cl)c1 |
| InChI | InChI=1S/C23H16ClFN2O2S/c24-20-18-10-9-16(25)12-19(18)30-21(20)23(29)26-13-14-5-4-6-15(11-14)22(28)27-17-7-2-1-3-8-17/h1-12H,13H2,(H,26,29)(H,27,28) |
| InChIKey | NTZJIXNTFDDYKA-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.91 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |