C17H11ClF3NO2S — CID 46081913
3-chloro-N-[[3-(difluoromethoxy)phenyl]methyl]-6-fluoro-1-benzothiophene-2-carboxamide (PubChem CID 46081913) has the molecular formula C17H11ClF3NO2S and a molecular weight of 385.79 g/mol. Its IUPAC name is 3-chloro-N-[[3-(difluoromethoxy)phenyl]methyl]-6-fluoro-1-benzothiophene-2-carboxamide.
| Compound Name | 3-chloro-N-[[3-(difluoromethoxy)phenyl]methyl]-6-fluoro-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 46081913 |
| Molecular Formula | C17H11ClF3NO2S |
| Molecular Weight | 385.79 g/mol |
| Exact Mass | 385.02 |
| IUPAC Name | 3-chloro-N-[[3-(difluoromethoxy)phenyl]methyl]-6-fluoro-1-benzothiophene-2-carboxamide |
| SMILES | O=C(NCc1cccc(OC(F)F)c1)c1sc2cc(F)ccc2c1Cl |
| InChI | InChI=1S/C17H11ClF3NO2S/c18-14-12-5-4-10(19)7-13(12)25-15(14)16(23)22-8-9-2-1-3-11(6-9)24-17(20)21/h1-7,17H,8H2,(H,22,23) |
| InChIKey | FCDITBSOOZWNOD-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.79 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |