C16H7ClF3NO3S — CID 5114852
[(3-chloro-6-fluoro-1-benzothiophene-2-carbonyl)amino] 2,6-difluorobenzoate (PubChem CID 5114852) has the molecular formula C16H7ClF3NO3S and a molecular weight of 385.75 g/mol. Its IUPAC name is [(3-chloro-6-fluoro-1-benzothiophene-2-carbonyl)amino] 2,6-difluorobenzoate.
| Compound Name | [(3-chloro-6-fluoro-1-benzothiophene-2-carbonyl)amino] 2,6-difluorobenzoate |
|---|---|
| PubChem CID | 5114852 |
| Molecular Formula | C16H7ClF3NO3S |
| Molecular Weight | 385.75 g/mol |
| Exact Mass | 384.98 |
| IUPAC Name | [(3-chloro-6-fluoro-1-benzothiophene-2-carbonyl)amino] 2,6-difluorobenzoate |
| SMILES | O=C(NOC(=O)c1c(F)cccc1F)c1sc2cc(F)ccc2c1Cl |
| InChI | InChI=1S/C16H7ClF3NO3S/c17-13-8-5-4-7(18)6-11(8)25-14(13)15(22)21-24-16(23)12-9(19)2-1-3-10(12)20/h1-6H,(H,21,22) |
| InChIKey | ASCOJQYPCRXXPZ-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.75 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|