C19H17ClFNO3S2 — CID 55663741
N-(3-benzylsulfonylpropyl)-3-chloro-6-fluoro-1-benzothiophene-2-carboxamide (PubChem CID 55663741) has the molecular formula C19H17ClFNO3S2 and a molecular weight of 425.93 g/mol. Its IUPAC name is N-(3-benzylsulfonylpropyl)-3-chloro-6-fluoro-1-benzothiophene-2-carboxamide.
| Compound Name | N-(3-benzylsulfonylpropyl)-3-chloro-6-fluoro-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 55663741 |
| Molecular Formula | C19H17ClFNO3S2 |
| Molecular Weight | 425.93 g/mol |
| Exact Mass | 425.03 |
| IUPAC Name | N-(3-benzylsulfonylpropyl)-3-chloro-6-fluoro-1-benzothiophene-2-carboxamide |
| SMILES | O=C(NCCCS(=O)(=O)Cc1ccccc1)c1sc2cc(F)ccc2c1Cl |
| InChI | InChI=1S/C19H17ClFNO3S2/c20-17-15-8-7-14(21)11-16(15)26-18(17)19(23)22-9-4-10-27(24,25)12-13-5-2-1-3-6-13/h1-3,5-8,11H,4,9-10,12H2,(H,22,23) |
| InChIKey | OENHUYMCWLMCKF-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.93 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|