C16H24FN3O2 — CID 51334001
1-[3-(2,6-dimethylmorpholin-4-yl)propyl]-3-(4-fluorophenyl)urea (PubChem CID 51334001) has the molecular formula C16H24FN3O2 and a molecular weight of 309.38 g/mol. Its IUPAC name is 1-[3-(2,6-dimethylmorpholin-4-yl)propyl]-3-(4-fluorophenyl)urea.
| Compound Name | 1-[3-(2,6-dimethylmorpholin-4-yl)propyl]-3-(4-fluorophenyl)urea |
|---|---|
| PubChem CID | 51334001 |
| Molecular Formula | C16H24FN3O2 |
| Molecular Weight | 309.38 g/mol |
| Exact Mass | 309.19 |
| IUPAC Name | 1-[3-(2,6-dimethylmorpholin-4-yl)propyl]-3-(4-fluorophenyl)urea |
| SMILES | CC1CN(CCCNC(=O)Nc2ccc(F)cc2)CC(C)O1 |
| InChI | InChI=1S/C16H24FN3O2/c1-12-10-20(11-13(2)22-12)9-3-8-18-16(21)19-15-6-4-14(17)5-7-15/h4-7,12-13H,3,8-11H2,1-2H3,(H2,18,19,21) |
| InChIKey | XRAHAFNXLLGJTK-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.38 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|