C13H23N5O2S — CID 95975570
1-[4-[(2S,6S)-2,6-dimethylmorpholin-4-yl]butyl]-3-(1,3,4-thiadiazol-2-yl)urea (PubChem CID 95975570) has the molecular formula C13H23N5O2S and a molecular weight of 313.43 g/mol. Its IUPAC name is 1-[4-[(2S,6S)-2,6-dimethylmorpholin-4-yl]butyl]-3-(1,3,4-thiadiazol-2-yl)urea.
| Compound Name | 1-[4-[(2S,6S)-2,6-dimethylmorpholin-4-yl]butyl]-3-(1,3,4-thiadiazol-2-yl)urea |
|---|---|
| PubChem CID | 95975570 |
| Molecular Formula | C13H23N5O2S |
| Molecular Weight | 313.43 g/mol |
| Exact Mass | 313.16 |
| IUPAC Name | 1-[4-[(2S,6S)-2,6-dimethylmorpholin-4-yl]butyl]-3-(1,3,4-thiadiazol-2-yl)urea |
| SMILES | C[C@H]1CN(CCCCNC(=O)Nc2nncs2)C[C@H](C)O1 |
| InChI | InChI=1S/C13H23N5O2S/c1-10-7-18(8-11(2)20-10)6-4-3-5-14-12(19)16-13-17-15-9-21-13/h9-11H,3-8H2,1-2H3,(H2,14,16,17,19)/t10-,11-/m0/s1 |
| InChIKey | JTIPIORVWTVKKP-QWRGUYRKSA-N |
| XLogP | 1.55 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.43 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|