C15H23N3O2 — CID 51725583
N-[3-[(2R,6R)-2,6-dimethylmorpholin-4-yl]propyl]pyridine-4-carboxamide (PubChem CID 51725583) has the molecular formula C15H23N3O2 and a molecular weight of 277.37 g/mol. Its IUPAC name is N-[3-[(2R,6R)-2,6-dimethylmorpholin-4-yl]propyl]pyridine-4-carboxamide.
| Compound Name | N-[3-[(2R,6R)-2,6-dimethylmorpholin-4-yl]propyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 51725583 |
| Molecular Formula | C15H23N3O2 |
| Molecular Weight | 277.37 g/mol |
| Exact Mass | 277.18 |
| IUPAC Name | N-[3-[(2R,6R)-2,6-dimethylmorpholin-4-yl]propyl]pyridine-4-carboxamide |
| SMILES | C[C@@H]1CN(CCCNC(=O)c2ccncc2)C[C@@H](C)O1 |
| InChI | InChI=1S/C15H23N3O2/c1-12-10-18(11-13(2)20-12)9-3-6-17-15(19)14-4-7-16-8-5-14/h4-5,7-8,12-13H,3,6,9-11H2,1-2H3,(H,17,19)/t12-,13-/m1/s1 |
| InChIKey | PGIRNMBDMYXKDG-CHWSQXEVSA-N |
| XLogP | 1.31 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.37 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|