C19H27N3O2 — CID 97024088
N-[4-[(2S,6R)-2,6-dimethylmorpholin-4-yl]butyl]-1H-indole-5-carboxamide (PubChem CID 97024088) has the molecular formula C19H27N3O2 and a molecular weight of 329.44 g/mol. Its IUPAC name is N-[4-[(2S,6R)-2,6-dimethylmorpholin-4-yl]butyl]-1H-indole-5-carboxamide.
| Compound Name | N-[4-[(2S,6R)-2,6-dimethylmorpholin-4-yl]butyl]-1H-indole-5-carboxamide |
|---|---|
| PubChem CID | 97024088 |
| Molecular Formula | C19H27N3O2 |
| Molecular Weight | 329.44 g/mol |
| Exact Mass | 329.21 |
| IUPAC Name | N-[4-[(2S,6R)-2,6-dimethylmorpholin-4-yl]butyl]-1H-indole-5-carboxamide |
| SMILES | C[C@@H]1CN(CCCCNC(=O)c2ccc3[nH]ccc3c2)C[C@H](C)O1 |
| InChI | InChI=1S/C19H27N3O2/c1-14-12-22(13-15(2)24-14)10-4-3-8-21-19(23)17-5-6-18-16(11-17)7-9-20-18/h5-7,9,11,14-15,20H,3-4,8,10,12-13H2,1-2H3,(H,21,23)/t14-,15+ |
| InChIKey | LYZWKGPLXAHXIT-GASCZTMLSA-N |
| XLogP | 2.79 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.44 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|