C18H26F2N2O4 — CID 51953209
3-(difluoromethoxy)-N-[3-[(2S,6S)-2,6-dimethylmorpholin-4-yl]propyl]-4-methoxybenzamide (PubChem CID 51953209) has the molecular formula C18H26F2N2O4 and a molecular weight of 372.41 g/mol. Its IUPAC name is 3-(difluoromethoxy)-N-[3-[(2S,6S)-2,6-dimethylmorpholin-4-yl]propyl]-4-methoxybenzamide.
| Compound Name | 3-(difluoromethoxy)-N-[3-[(2S,6S)-2,6-dimethylmorpholin-4-yl]propyl]-4-methoxybenzamide |
|---|---|
| PubChem CID | 51953209 |
| Molecular Formula | C18H26F2N2O4 |
| Molecular Weight | 372.41 g/mol |
| Exact Mass | 372.19 |
| IUPAC Name | 3-(difluoromethoxy)-N-[3-[(2S,6S)-2,6-dimethylmorpholin-4-yl]propyl]-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)NCCCN2C[C@H](C)O[C@@H](C)C2)cc1OC(F)F |
| InChI | InChI=1S/C18H26F2N2O4/c1-12-10-22(11-13(2)25-12)8-4-7-21-17(23)14-5-6-15(24-3)16(9-14)26-18(19)20/h5-6,9,12-13,18H,4,7-8,10-11H2,1-3H3,(H,21,23)/t12-,13-/m0/s1 |
| InChIKey | DOUVLGINPQAKQP-STQMWFEESA-N |
| XLogP | 2.53 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.41 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|