C13H15F2NO5S — CID 119241438
2-[2-[[3-(difluoromethoxy)-4-methoxybenzoyl]amino]ethylsulfanyl]acetic acid (PubChem CID 119241438) has the molecular formula C13H15F2NO5S and a molecular weight of 335.33 g/mol. Its IUPAC name is 2-[2-[[3-(difluoromethoxy)-4-methoxybenzoyl]amino]ethylsulfanyl]acetic acid.
| Compound Name | 2-[2-[[3-(difluoromethoxy)-4-methoxybenzoyl]amino]ethylsulfanyl]acetic acid |
|---|---|
| PubChem CID | 119241438 |
| Molecular Formula | C13H15F2NO5S |
| Molecular Weight | 335.33 g/mol |
| Exact Mass | 335.06 |
| IUPAC Name | 2-[2-[[3-(difluoromethoxy)-4-methoxybenzoyl]amino]ethylsulfanyl]acetic acid |
| SMILES | COc1ccc(C(=O)NCCSCC(=O)O)cc1OC(F)F |
| InChI | InChI=1S/C13H15F2NO5S/c1-20-9-3-2-8(6-10(9)21-13(14)15)12(19)16-4-5-22-7-11(17)18/h2-3,6,13H,4-5,7H2,1H3,(H,16,19)(H,17,18) |
| InChIKey | FEAYXCCVNNWRCA-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.33 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|