C18H19F2NO4 — CID 55739120
3-(difluoromethoxy)-4-methoxy-N-(3-phenoxypropyl)benzamide (PubChem CID 55739120) has the molecular formula C18H19F2NO4 and a molecular weight of 351.35 g/mol. Its IUPAC name is 3-(difluoromethoxy)-4-methoxy-N-(3-phenoxypropyl)benzamide.
| Compound Name | 3-(difluoromethoxy)-4-methoxy-N-(3-phenoxypropyl)benzamide |
|---|---|
| PubChem CID | 55739120 |
| Molecular Formula | C18H19F2NO4 |
| Molecular Weight | 351.35 g/mol |
| Exact Mass | 351.13 |
| IUPAC Name | 3-(difluoromethoxy)-4-methoxy-N-(3-phenoxypropyl)benzamide |
| SMILES | COc1ccc(C(=O)NCCCOc2ccccc2)cc1OC(F)F |
| InChI | InChI=1S/C18H19F2NO4/c1-23-15-9-8-13(12-16(15)25-18(19)20)17(22)21-10-5-11-24-14-6-3-2-4-7-14/h2-4,6-9,12,18H,5,10-11H2,1H3,(H,21,22) |
| InChIKey | CKVNRKVHVVIQEA-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.35 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|