C18H18F3NO3S — CID 55741143
3-(difluoromethoxy)-N-[3-(4-fluorophenyl)sulfanylpropyl]-4-methoxybenzamide (PubChem CID 55741143) has the molecular formula C18H18F3NO3S and a molecular weight of 385.41 g/mol. Its IUPAC name is 3-(difluoromethoxy)-N-[3-(4-fluorophenyl)sulfanylpropyl]-4-methoxybenzamide.
| Compound Name | 3-(difluoromethoxy)-N-[3-(4-fluorophenyl)sulfanylpropyl]-4-methoxybenzamide |
|---|---|
| PubChem CID | 55741143 |
| Molecular Formula | C18H18F3NO3S |
| Molecular Weight | 385.41 g/mol |
| Exact Mass | 385.10 |
| IUPAC Name | 3-(difluoromethoxy)-N-[3-(4-fluorophenyl)sulfanylpropyl]-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)NCCCSc2ccc(F)cc2)cc1OC(F)F |
| InChI | InChI=1S/C18H18F3NO3S/c1-24-15-8-3-12(11-16(15)25-18(20)21)17(23)22-9-2-10-26-14-6-4-13(19)5-7-14/h3-8,11,18H,2,9-10H2,1H3,(H,22,23) |
| InChIKey | AZQHCQUBUGUCFW-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.41 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|