C17H16ClF2NO4 — CID 46489928
N-[2-(4-chlorophenoxy)ethyl]-3-(difluoromethoxy)-4-methoxybenzamide (PubChem CID 46489928) has the molecular formula C17H16ClF2NO4 and a molecular weight of 371.77 g/mol. Its IUPAC name is N-[2-(4-chlorophenoxy)ethyl]-3-(difluoromethoxy)-4-methoxybenzamide.
| Compound Name | N-[2-(4-chlorophenoxy)ethyl]-3-(difluoromethoxy)-4-methoxybenzamide |
|---|---|
| PubChem CID | 46489928 |
| Molecular Formula | C17H16ClF2NO4 |
| Molecular Weight | 371.77 g/mol |
| Exact Mass | 371.07 |
| IUPAC Name | N-[2-(4-chlorophenoxy)ethyl]-3-(difluoromethoxy)-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)NCCOc2ccc(Cl)cc2)cc1OC(F)F |
| InChI | InChI=1S/C17H16ClF2NO4/c1-23-14-7-2-11(10-15(14)25-17(19)20)16(22)21-8-9-24-13-5-3-12(18)4-6-13/h2-7,10,17H,8-9H2,1H3,(H,21,22) |
| InChIKey | HTCBBLUUJKMBRZ-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.77 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|