C19H20ClNO6 — CID 3524412
2-(4-chlorophenoxy)ethyl 2-[(3,4-dimethoxybenzoyl)amino]acetate (PubChem CID 3524412) has the molecular formula C19H20ClNO6 and a molecular weight of 393.82 g/mol. Its IUPAC name is 2-(4-chlorophenoxy)ethyl 2-[(3,4-dimethoxybenzoyl)amino]acetate.
| Compound Name | 2-(4-chlorophenoxy)ethyl 2-[(3,4-dimethoxybenzoyl)amino]acetate |
|---|---|
| PubChem CID | 3524412 |
| Molecular Formula | C19H20ClNO6 |
| Molecular Weight | 393.82 g/mol |
| Exact Mass | 393.10 |
| IUPAC Name | 2-(4-chlorophenoxy)ethyl 2-[(3,4-dimethoxybenzoyl)amino]acetate |
| SMILES | COc1ccc(C(=O)NCC(=O)OCCOc2ccc(Cl)cc2)cc1OC |
| InChI | InChI=1S/C19H20ClNO6/c1-24-16-8-3-13(11-17(16)25-2)19(23)21-12-18(22)27-10-9-26-15-6-4-14(20)5-7-15/h3-8,11H,9-10,12H2,1-2H3,(H,21,23) |
| InChIKey | FNFHHGYONFWLED-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.82 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|