C18H17Cl2NO5 — CID 8933305
(2,6-dichlorophenyl)methyl 2-[(3,4-dimethoxybenzoyl)amino]acetate (PubChem CID 8933305) has the molecular formula C18H17Cl2NO5 and a molecular weight of 398.24 g/mol. Its IUPAC name is (2,6-dichlorophenyl)methyl 2-[(3,4-dimethoxybenzoyl)amino]acetate.
| Compound Name | (2,6-dichlorophenyl)methyl 2-[(3,4-dimethoxybenzoyl)amino]acetate |
|---|---|
| PubChem CID | 8933305 |
| Molecular Formula | C18H17Cl2NO5 |
| Molecular Weight | 398.24 g/mol |
| Exact Mass | 397.05 |
| IUPAC Name | (2,6-dichlorophenyl)methyl 2-[(3,4-dimethoxybenzoyl)amino]acetate |
| SMILES | COc1ccc(C(=O)NCC(=O)OCc2c(Cl)cccc2Cl)cc1OC |
| InChI | InChI=1S/C18H17Cl2NO5/c1-24-15-7-6-11(8-16(15)25-2)18(23)21-9-17(22)26-10-12-13(19)4-3-5-14(12)20/h3-8H,9-10H2,1-2H3,(H,21,23) |
| InChIKey | VDHYLPOYPDEPSK-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.24 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |