C20H19NO5S — CID 55885872
1-benzothiophen-3-ylmethyl 2-[(3,4-dimethoxybenzoyl)amino]acetate (PubChem CID 55885872) has the molecular formula C20H19NO5S and a molecular weight of 385.44 g/mol. Its IUPAC name is 1-benzothiophen-3-ylmethyl 2-[(3,4-dimethoxybenzoyl)amino]acetate.
| Compound Name | 1-benzothiophen-3-ylmethyl 2-[(3,4-dimethoxybenzoyl)amino]acetate |
|---|---|
| PubChem CID | 55885872 |
| Molecular Formula | C20H19NO5S |
| Molecular Weight | 385.44 g/mol |
| Exact Mass | 385.10 |
| IUPAC Name | 1-benzothiophen-3-ylmethyl 2-[(3,4-dimethoxybenzoyl)amino]acetate |
| SMILES | COc1ccc(C(=O)NCC(=O)OCc2csc3ccccc23)cc1OC |
| InChI | InChI=1S/C20H19NO5S/c1-24-16-8-7-13(9-17(16)25-2)20(23)21-10-19(22)26-11-14-12-27-18-6-4-3-5-15(14)18/h3-9,12H,10-11H2,1-2H3,(H,21,23) |
| InChIKey | YBACSIXJXQEARS-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.44 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |