C18H14FNO3S — CID 55886268
1-benzothiophen-3-ylmethyl 2-[(2-fluorobenzoyl)amino]acetate (PubChem CID 55886268) has the molecular formula C18H14FNO3S and a molecular weight of 343.38 g/mol. Its IUPAC name is 1-benzothiophen-3-ylmethyl 2-[(2-fluorobenzoyl)amino]acetate.
| Compound Name | 1-benzothiophen-3-ylmethyl 2-[(2-fluorobenzoyl)amino]acetate |
|---|---|
| PubChem CID | 55886268 |
| Molecular Formula | C18H14FNO3S |
| Molecular Weight | 343.38 g/mol |
| Exact Mass | 343.07 |
| IUPAC Name | 1-benzothiophen-3-ylmethyl 2-[(2-fluorobenzoyl)amino]acetate |
| SMILES | O=C(CNC(=O)c1ccccc1F)OCc1csc2ccccc12 |
| InChI | InChI=1S/C18H14FNO3S/c19-15-7-3-1-6-14(15)18(22)20-9-17(21)23-10-12-11-24-16-8-4-2-5-13(12)16/h1-8,11H,9-10H2,(H,20,22) |
| InChIKey | PPJUUBGQYMJHTC-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.38 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |