C16H12Cl2FNO3 — CID 31864850
(3,4-dichlorophenyl)methyl 2-[(2-fluorobenzoyl)amino]acetate (PubChem CID 31864850) has the molecular formula C16H12Cl2FNO3 and a molecular weight of 356.18 g/mol. Its IUPAC name is (3,4-dichlorophenyl)methyl 2-[(2-fluorobenzoyl)amino]acetate.
| Compound Name | (3,4-dichlorophenyl)methyl 2-[(2-fluorobenzoyl)amino]acetate |
|---|---|
| PubChem CID | 31864850 |
| Molecular Formula | C16H12Cl2FNO3 |
| Molecular Weight | 356.18 g/mol |
| Exact Mass | 355.02 |
| IUPAC Name | (3,4-dichlorophenyl)methyl 2-[(2-fluorobenzoyl)amino]acetate |
| SMILES | O=C(CNC(=O)c1ccccc1F)OCc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C16H12Cl2FNO3/c17-12-6-5-10(7-13(12)18)9-23-15(21)8-20-16(22)11-3-1-2-4-14(11)19/h1-7H,8-9H2,(H,20,22) |
| InChIKey | MJKSEMKFXSVJCJ-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.18 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |