C15H18FNO4 — CID 9270451
(3,3-dimethyl-2-oxobutyl) 2-[(2-fluorobenzoyl)amino]acetate (PubChem CID 9270451) has the molecular formula C15H18FNO4 and a molecular weight of 295.31 g/mol. Its IUPAC name is (3,3-dimethyl-2-oxobutyl) 2-[(2-fluorobenzoyl)amino]acetate.
| Compound Name | (3,3-dimethyl-2-oxobutyl) 2-[(2-fluorobenzoyl)amino]acetate |
|---|---|
| PubChem CID | 9270451 |
| Molecular Formula | C15H18FNO4 |
| Molecular Weight | 295.31 g/mol |
| Exact Mass | 295.12 |
| IUPAC Name | (3,3-dimethyl-2-oxobutyl) 2-[(2-fluorobenzoyl)amino]acetate |
| SMILES | CC(C)(C)C(=O)COC(=O)CNC(=O)c1ccccc1F |
| InChI | InChI=1S/C15H18FNO4/c1-15(2,3)12(18)9-21-13(19)8-17-14(20)10-6-4-5-7-11(10)16/h4-7H,8-9H2,1-3H3,(H,17,20) |
| InChIKey | XGTPOYODDWKYBG-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.31 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |