C20H14ClNO3S2 — CID 55884820
1-benzothiophen-3-ylmethyl 2-[(3-chloro-1-benzothiophene-2-carbonyl)amino]acetate (PubChem CID 55884820) has the molecular formula C20H14ClNO3S2 and a molecular weight of 415.92 g/mol. Its IUPAC name is 1-benzothiophen-3-ylmethyl 2-[(3-chloro-1-benzothiophene-2-carbonyl)amino]acetate.
| Compound Name | 1-benzothiophen-3-ylmethyl 2-[(3-chloro-1-benzothiophene-2-carbonyl)amino]acetate |
|---|---|
| PubChem CID | 55884820 |
| Molecular Formula | C20H14ClNO3S2 |
| Molecular Weight | 415.92 g/mol |
| Exact Mass | 415.01 |
| IUPAC Name | 1-benzothiophen-3-ylmethyl 2-[(3-chloro-1-benzothiophene-2-carbonyl)amino]acetate |
| SMILES | O=C(CNC(=O)c1sc2ccccc2c1Cl)OCc1csc2ccccc12 |
| InChI | InChI=1S/C20H14ClNO3S2/c21-18-14-6-2-4-8-16(14)27-19(18)20(24)22-9-17(23)25-10-12-11-26-15-7-3-1-5-13(12)15/h1-8,11H,9-10H2,(H,22,24) |
| InChIKey | BSUGUVCOUKBDET-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.92 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |