About 1-benzothiophen-3-ylmethyl 4-methylpentanoate
1-benzothiophen-3-ylmethyl 4-methylpentanoate (PubChem CID 55885356) has the molecular formula C15H18O2S
and a molecular weight of 262.37 g/mol. Its IUPAC name is 1-benzothiophen-3-ylmethyl 4-methylpentanoate.
Molecular Properties
| Compound Name | 1-benzothiophen-3-ylmethyl 4-methylpentanoate |
| PubChem CID | 55885356 |
| Molecular Formula | C15H18O2S |
| Molecular Weight | 262.37 g/mol |
| Exact Mass | 262.10 |
| IUPAC Name | 1-benzothiophen-3-ylmethyl 4-methylpentanoate |
| SMILES | CC(C)CCC(=O)OCc1csc2ccccc12 |
| InChI | InChI=1S/C15H18O2S/c1-11(2)7-8-15(16)17-9-12-10-18-14-6-4-3-5-13(12)14/h3-6,10-11H,7-9H2,1-2H3 |
| InChIKey | SKVFINUTMYOJSS-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.37 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-benzothiophen-3-ylmethyl 4-methylpentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzothiophen-3-ylmethyl 4-methylpentanoate?
The IUPAC name of 1-benzothiophen-3-ylmethyl 4-methylpentanoate (CID 55885356) is 1-benzothiophen-3-ylmethyl 4-methylpentanoate.
What is the SMILES notation for 1-benzothiophen-3-ylmethyl 4-methylpentanoate?
The canonical SMILES for 1-benzothiophen-3-ylmethyl 4-methylpentanoate is CC(C)CCC(=O)OCc1csc2ccccc12.
What is the InChIKey of 1-benzothiophen-3-ylmethyl 4-methylpentanoate?
The InChIKey is SKVFINUTMYOJSS-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18O2S/c1-11(2)7-8-15(16)17-9-12-10-18-14-6-4-3-5-13(12)14/h3-6,10-11H,7-9H2,1-2H3.
What are the key properties of 1-benzothiophen-3-ylmethyl 4-methylpentanoate?
1-benzothiophen-3-ylmethyl 4-methylpentanoate has a molecular weight of 262.37 g/mol, XLogP of 4.38, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzothiophen-3-ylmethyl 4-methylpentanoate is sourced from PubChem (CID 55885356), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).