C16H21NOS — CID 86990643
N-(1-benzothiophen-3-ylmethyl)-N,4-dimethylpentanamide (PubChem CID 86990643) has the molecular formula C16H21NOS and a molecular weight of 275.42 g/mol. Its IUPAC name is N-(1-benzothiophen-3-ylmethyl)-N,4-dimethylpentanamide.
| Compound Name | N-(1-benzothiophen-3-ylmethyl)-N,4-dimethylpentanamide |
|---|---|
| PubChem CID | 86990643 |
| Molecular Formula | C16H21NOS |
| Molecular Weight | 275.42 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | N-(1-benzothiophen-3-ylmethyl)-N,4-dimethylpentanamide |
| SMILES | CC(C)CCC(=O)N(C)Cc1csc2ccccc12 |
| InChI | InChI=1S/C16H21NOS/c1-12(2)8-9-16(18)17(3)10-13-11-19-15-7-5-4-6-14(13)15/h4-7,11-12H,8-10H2,1-3H3 |
| InChIKey | GLBRPSSDVIQAPX-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.42 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |