C18H21NO3S — CID 120672892
4-[1-benzothiophen-3-ylmethyl(methyl)carbamoyl]cyclohexane-1-carboxylic acid (PubChem CID 120672892) has the molecular formula C18H21NO3S and a molecular weight of 331.44 g/mol. Its IUPAC name is 4-[1-benzothiophen-3-ylmethyl(methyl)carbamoyl]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[1-benzothiophen-3-ylmethyl(methyl)carbamoyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 120672892 |
| Molecular Formula | C18H21NO3S |
| Molecular Weight | 331.44 g/mol |
| Exact Mass | 331.12 |
| IUPAC Name | 4-[1-benzothiophen-3-ylmethyl(methyl)carbamoyl]cyclohexane-1-carboxylic acid |
| SMILES | CN(Cc1csc2ccccc12)C(=O)C1CCC(C(=O)O)CC1 |
| InChI | InChI=1S/C18H21NO3S/c1-19(10-14-11-23-16-5-3-2-4-15(14)16)17(20)12-6-8-13(9-7-12)18(21)22/h2-5,11-13H,6-10H2,1H3,(H,21,22) |
| InChIKey | FLTOWUWKUMFNRC-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.44 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |