C17H20N2O2S — CID 125144168
(3R)-N-(1-benzothiophen-3-ylmethyl)-N,1-dimethyl-2-oxopiperidine-3-carboxamide (PubChem CID 125144168) has the molecular formula C17H20N2O2S and a molecular weight of 316.43 g/mol. Its IUPAC name is (3R)-N-(1-benzothiophen-3-ylmethyl)-N,1-dimethyl-2-oxopiperidine-3-carboxamide.
| Compound Name | (3R)-N-(1-benzothiophen-3-ylmethyl)-N,1-dimethyl-2-oxopiperidine-3-carboxamide |
|---|---|
| PubChem CID | 125144168 |
| Molecular Formula | C17H20N2O2S |
| Molecular Weight | 316.43 g/mol |
| Exact Mass | 316.12 |
| IUPAC Name | (3R)-N-(1-benzothiophen-3-ylmethyl)-N,1-dimethyl-2-oxopiperidine-3-carboxamide |
| SMILES | CN1CCC[C@@H](C(=O)N(C)Cc2csc3ccccc23)C1=O |
| InChI | InChI=1S/C17H20N2O2S/c1-18-9-5-7-14(16(18)20)17(21)19(2)10-12-11-22-15-8-4-3-6-13(12)15/h3-4,6,8,11,14H,5,7,9-10H2,1-2H3/t14-/m1/s1 |
| InChIKey | CXPPJPQVQHAYNA-CQSZACIVSA-N |
| XLogP | 2.73 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.43 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|