C15H20N2O3S2 — CID 119956414
2-amino-N-(1-benzothiophen-3-ylmethyl)-N-methyl-4-methylsulfonylbutanamide (PubChem CID 119956414) has the molecular formula C15H20N2O3S2 and a molecular weight of 340.47 g/mol. Its IUPAC name is 2-amino-N-(1-benzothiophen-3-ylmethyl)-N-methyl-4-methylsulfonylbutanamide.
| Compound Name | 2-amino-N-(1-benzothiophen-3-ylmethyl)-N-methyl-4-methylsulfonylbutanamide |
|---|---|
| PubChem CID | 119956414 |
| Molecular Formula | C15H20N2O3S2 |
| Molecular Weight | 340.47 g/mol |
| Exact Mass | 340.09 |
| IUPAC Name | 2-amino-N-(1-benzothiophen-3-ylmethyl)-N-methyl-4-methylsulfonylbutanamide |
| SMILES | CN(Cc1csc2ccccc12)C(=O)C(N)CCS(C)(=O)=O |
| InChI | InChI=1S/C15H20N2O3S2/c1-17(15(18)13(16)7-8-22(2,19)20)9-11-10-21-14-6-4-3-5-12(11)14/h3-6,10,13H,7-9,16H2,1-2H3 |
| InChIKey | JPGZARIGNRNUSG-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.47 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |