C14H22N2O3S2 — CID 60937787
2-amino-N-methyl-N-[(4-methylsulfanylphenyl)methyl]-4-methylsulfonylbutanamide (PubChem CID 60937787) has the molecular formula C14H22N2O3S2 and a molecular weight of 330.47 g/mol. Its IUPAC name is 2-amino-N-methyl-N-[(4-methylsulfanylphenyl)methyl]-4-methylsulfonylbutanamide.
| Compound Name | 2-amino-N-methyl-N-[(4-methylsulfanylphenyl)methyl]-4-methylsulfonylbutanamide |
|---|---|
| PubChem CID | 60937787 |
| Molecular Formula | C14H22N2O3S2 |
| Molecular Weight | 330.47 g/mol |
| Exact Mass | 330.11 |
| IUPAC Name | 2-amino-N-methyl-N-[(4-methylsulfanylphenyl)methyl]-4-methylsulfonylbutanamide |
| SMILES | CSc1ccc(CN(C)C(=O)C(N)CCS(C)(=O)=O)cc1 |
| InChI | InChI=1S/C14H22N2O3S2/c1-16(10-11-4-6-12(20-2)7-5-11)14(17)13(15)8-9-21(3,18)19/h4-7,13H,8-10,15H2,1-3H3 |
| InChIKey | XKYDSJRDTFWFQE-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.47 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |