C11H17BrN2O4S — CID 54873405
2-amino-N-[(5-bromofuran-2-yl)methyl]-N-methyl-4-methylsulfonylbutanamide (PubChem CID 54873405) has the molecular formula C11H17BrN2O4S and a molecular weight of 353.24 g/mol. Its IUPAC name is 2-amino-N-[(5-bromofuran-2-yl)methyl]-N-methyl-4-methylsulfonylbutanamide.
| Compound Name | 2-amino-N-[(5-bromofuran-2-yl)methyl]-N-methyl-4-methylsulfonylbutanamide |
|---|---|
| PubChem CID | 54873405 |
| Molecular Formula | C11H17BrN2O4S |
| Molecular Weight | 353.24 g/mol |
| Exact Mass | 352.01 |
| IUPAC Name | 2-amino-N-[(5-bromofuran-2-yl)methyl]-N-methyl-4-methylsulfonylbutanamide |
| SMILES | CN(Cc1ccc(Br)o1)C(=O)C(N)CCS(C)(=O)=O |
| InChI | InChI=1S/C11H17BrN2O4S/c1-14(7-8-3-4-10(12)18-8)11(15)9(13)5-6-19(2,16)17/h3-4,9H,5-7,13H2,1-2H3 |
| InChIKey | KIZJLEJBCQJESM-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 93.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.24 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |