C10H13BrN2O4 — CID 64896124
3-amino-4-[(5-bromofuran-2-yl)methyl-methylamino]-4-oxobutanoic acid (PubChem CID 64896124) has the molecular formula C10H13BrN2O4 and a molecular weight of 305.13 g/mol. Its IUPAC name is 3-amino-4-[(5-bromofuran-2-yl)methyl-methylamino]-4-oxobutanoic acid.
| Compound Name | 3-amino-4-[(5-bromofuran-2-yl)methyl-methylamino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 64896124 |
| Molecular Formula | C10H13BrN2O4 |
| Molecular Weight | 305.13 g/mol |
| Exact Mass | 304.01 |
| IUPAC Name | 3-amino-4-[(5-bromofuran-2-yl)methyl-methylamino]-4-oxobutanoic acid |
| SMILES | CN(Cc1ccc(Br)o1)C(=O)C(N)CC(=O)O |
| InChI | InChI=1S/C10H13BrN2O4/c1-13(5-6-2-3-8(11)17-6)10(16)7(12)4-9(14)15/h2-3,7H,4-5,12H2,1H3,(H,14,15) |
| InChIKey | VOXQLWYGFJQIFS-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 96.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.13 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |