C12H19BrN2O2 — CID 65227055
2-(aminomethyl)-N-[(5-bromofuran-2-yl)methyl]-N-methylpentanamide (PubChem CID 65227055) has the molecular formula C12H19BrN2O2 and a molecular weight of 303.20 g/mol. Its IUPAC name is 2-(aminomethyl)-N-[(5-bromofuran-2-yl)methyl]-N-methylpentanamide.
| Compound Name | 2-(aminomethyl)-N-[(5-bromofuran-2-yl)methyl]-N-methylpentanamide |
|---|---|
| PubChem CID | 65227055 |
| Molecular Formula | C12H19BrN2O2 |
| Molecular Weight | 303.20 g/mol |
| Exact Mass | 302.06 |
| IUPAC Name | 2-(aminomethyl)-N-[(5-bromofuran-2-yl)methyl]-N-methylpentanamide |
| SMILES | CCCC(CN)C(=O)N(C)Cc1ccc(Br)o1 |
| InChI | InChI=1S/C12H19BrN2O2/c1-3-4-9(7-14)12(16)15(2)8-10-5-6-11(13)17-10/h5-6,9H,3-4,7-8,14H2,1-2H3 |
| InChIKey | BTVCFUADMQRLDF-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 59.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.20 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |