C7H9BrN2O2 — CID 131134231
1-[(5-bromofuran-2-yl)methyl]-1-methylurea (PubChem CID 131134231) has the molecular formula C7H9BrN2O2 and a molecular weight of 233.06 g/mol. Its IUPAC name is 1-[(5-bromofuran-2-yl)methyl]-1-methylurea.
| Compound Name | 1-[(5-bromofuran-2-yl)methyl]-1-methylurea |
|---|---|
| PubChem CID | 131134231 |
| Molecular Formula | C7H9BrN2O2 |
| Molecular Weight | 233.06 g/mol |
| Exact Mass | 231.98 |
| IUPAC Name | 1-[(5-bromofuran-2-yl)methyl]-1-methylurea |
| SMILES | CN(Cc1ccc(Br)o1)C(N)=O |
| InChI | InChI=1S/C7H9BrN2O2/c1-10(7(9)11)4-5-2-3-6(8)12-5/h2-3H,4H2,1H3,(H2,9,11) |
| InChIKey | HUPIJSWZKDYCSJ-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 59.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.06 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |