C6H9BrN2O3S — CID 112684674
2-bromo-5-[[methyl(sulfamoyl)amino]methyl]furan (PubChem CID 112684674) has the molecular formula C6H9BrN2O3S and a molecular weight of 269.12 g/mol. Its IUPAC name is 2-bromo-5-[[methyl(sulfamoyl)amino]methyl]furan.
| Compound Name | 2-bromo-5-[[methyl(sulfamoyl)amino]methyl]furan |
|---|---|
| PubChem CID | 112684674 |
| Molecular Formula | C6H9BrN2O3S |
| Molecular Weight | 269.12 g/mol |
| Exact Mass | 267.95 |
| IUPAC Name | 2-bromo-5-[[methyl(sulfamoyl)amino]methyl]furan |
| SMILES | CN(Cc1ccc(Br)o1)S(N)(=O)=O |
| InChI | InChI=1S/C6H9BrN2O3S/c1-9(13(8,10)11)4-5-2-3-6(7)12-5/h2-3H,4H2,1H3,(H2,8,10,11) |
| InChIKey | RCHOXFYXXJJYFZ-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 76.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.12 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |