C14H17BrN2O3S — CID 61115072
3-amino-N-[(5-bromofuran-2-yl)methyl]-N,4,5-trimethylbenzenesulfonamide (PubChem CID 61115072) has the molecular formula C14H17BrN2O3S and a molecular weight of 373.27 g/mol. Its IUPAC name is 3-amino-N-[(5-bromofuran-2-yl)methyl]-N,4,5-trimethylbenzenesulfonamide.
| Compound Name | 3-amino-N-[(5-bromofuran-2-yl)methyl]-N,4,5-trimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 61115072 |
| Molecular Formula | C14H17BrN2O3S |
| Molecular Weight | 373.27 g/mol |
| Exact Mass | 372.01 |
| IUPAC Name | 3-amino-N-[(5-bromofuran-2-yl)methyl]-N,4,5-trimethylbenzenesulfonamide |
| SMILES | Cc1cc(S(=O)(=O)N(C)Cc2ccc(Br)o2)cc(N)c1C |
| InChI | InChI=1S/C14H17BrN2O3S/c1-9-6-12(7-13(16)10(9)2)21(18,19)17(3)8-11-4-5-14(15)20-11/h4-7H,8,16H2,1-3H3 |
| InChIKey | YWZSTCZYKKQPOT-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 76.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.27 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|