C11H10BrNO5S2 — CID 61073791
4-[(5-bromofuran-2-yl)methyl-methylsulfamoyl]thiophene-2-carboxylic acid (PubChem CID 61073791) has the molecular formula C11H10BrNO5S2 and a molecular weight of 380.24 g/mol. Its IUPAC name is 4-[(5-bromofuran-2-yl)methyl-methylsulfamoyl]thiophene-2-carboxylic acid.
| Compound Name | 4-[(5-bromofuran-2-yl)methyl-methylsulfamoyl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 61073791 |
| Molecular Formula | C11H10BrNO5S2 |
| Molecular Weight | 380.24 g/mol |
| Exact Mass | 378.92 |
| IUPAC Name | 4-[(5-bromofuran-2-yl)methyl-methylsulfamoyl]thiophene-2-carboxylic acid |
| SMILES | CN(Cc1ccc(Br)o1)S(=O)(=O)c1csc(C(=O)O)c1 |
| InChI | InChI=1S/C11H10BrNO5S2/c1-13(5-7-2-3-10(12)18-7)20(16,17)8-4-9(11(14)15)19-6-8/h2-4,6H,5H2,1H3,(H,14,15) |
| InChIKey | CWEKEUHCAXPRBE-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 87.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.24 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |