C13H14N2O3S2 — CID 6486033
4-[benzyl(methyl)sulfamoyl]thiophene-2-carboxamide (PubChem CID 6486033) has the molecular formula C13H14N2O3S2 and a molecular weight of 310.40 g/mol. Its IUPAC name is 4-[benzyl(methyl)sulfamoyl]thiophene-2-carboxamide.
| Compound Name | 4-[benzyl(methyl)sulfamoyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 6486033 |
| Molecular Formula | C13H14N2O3S2 |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.04 |
| IUPAC Name | 4-[benzyl(methyl)sulfamoyl]thiophene-2-carboxamide |
| SMILES | CN(Cc1ccccc1)S(=O)(=O)c1csc(C(N)=O)c1 |
| InChI | InChI=1S/C13H14N2O3S2/c1-15(8-10-5-3-2-4-6-10)20(17,18)11-7-12(13(14)16)19-9-11/h2-7,9H,8H2,1H3,(H2,14,16) |
| InChIKey | VWDALUKSVALIQR-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |