C17H20N2O3S2 — CID 50777828
N-benzyl-N-methyl-4-(pyrrolidine-1-carbonyl)thiophene-2-sulfonamide (PubChem CID 50777828) has the molecular formula C17H20N2O3S2 and a molecular weight of 364.49 g/mol. Its IUPAC name is N-benzyl-N-methyl-4-(pyrrolidine-1-carbonyl)thiophene-2-sulfonamide.
| Compound Name | N-benzyl-N-methyl-4-(pyrrolidine-1-carbonyl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 50777828 |
| Molecular Formula | C17H20N2O3S2 |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.09 |
| IUPAC Name | N-benzyl-N-methyl-4-(pyrrolidine-1-carbonyl)thiophene-2-sulfonamide |
| SMILES | CN(Cc1ccccc1)S(=O)(=O)c1cc(C(=O)N2CCCC2)cs1 |
| InChI | InChI=1S/C17H20N2O3S2/c1-18(12-14-7-3-2-4-8-14)24(21,22)16-11-15(13-23-16)17(20)19-9-5-6-10-19/h2-4,7-8,11,13H,5-6,9-10,12H2,1H3 |
| InChIKey | ZWIORRRDNMTZFT-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |