C16H19N3O3S2 — CID 39191268
4-(4-benzylpiperazine-1-carbonyl)thiophene-2-sulfonamide (PubChem CID 39191268) has the molecular formula C16H19N3O3S2 and a molecular weight of 365.48 g/mol. Its IUPAC name is 4-(4-benzylpiperazine-1-carbonyl)thiophene-2-sulfonamide.
| Compound Name | 4-(4-benzylpiperazine-1-carbonyl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 39191268 |
| Molecular Formula | C16H19N3O3S2 |
| Molecular Weight | 365.48 g/mol |
| Exact Mass | 365.09 |
| IUPAC Name | 4-(4-benzylpiperazine-1-carbonyl)thiophene-2-sulfonamide |
| SMILES | NS(=O)(=O)c1cc(C(=O)N2CCN(Cc3ccccc3)CC2)cs1 |
| InChI | InChI=1S/C16H19N3O3S2/c17-24(21,22)15-10-14(12-23-15)16(20)19-8-6-18(7-9-19)11-13-4-2-1-3-5-13/h1-5,10,12H,6-9,11H2,(H2,17,21,22) |
| InChIKey | XMNAYAAZHSEHKG-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 83.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.48 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |