C14H16ClN3O3S3 — CID 134061909
4-[4-[(5-chlorothiophen-2-yl)methyl]piperazine-1-carbonyl]thiophene-2-sulfonamide (PubChem CID 134061909) has the molecular formula C14H16ClN3O3S3 and a molecular weight of 405.95 g/mol. Its IUPAC name is 4-[4-[(5-chlorothiophen-2-yl)methyl]piperazine-1-carbonyl]thiophene-2-sulfonamide.
| Compound Name | 4-[4-[(5-chlorothiophen-2-yl)methyl]piperazine-1-carbonyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 134061909 |
| Molecular Formula | C14H16ClN3O3S3 |
| Molecular Weight | 405.95 g/mol |
| Exact Mass | 405.00 |
| IUPAC Name | 4-[4-[(5-chlorothiophen-2-yl)methyl]piperazine-1-carbonyl]thiophene-2-sulfonamide |
| SMILES | NS(=O)(=O)c1cc(C(=O)N2CCN(Cc3ccc(Cl)s3)CC2)cs1 |
| InChI | InChI=1S/C14H16ClN3O3S3/c15-12-2-1-11(23-12)8-17-3-5-18(6-4-17)14(19)10-7-13(22-9-10)24(16,20)21/h1-2,7,9H,3-6,8H2,(H2,16,20,21) |
| InChIKey | UIHAJWJTCINNQL-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 83.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.95 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |