C19H21ClFN3O3S2 — CID 55595841
5-[4-[(5-chlorothiophen-2-yl)methyl]piperazine-1-carbonyl]-2-fluoro-N-prop-2-enylbenzenesulfonamide (PubChem CID 55595841) has the molecular formula C19H21ClFN3O3S2 and a molecular weight of 457.98 g/mol. Its IUPAC name is 5-[4-[(5-chlorothiophen-2-yl)methyl]piperazine-1-carbonyl]-2-fluoro-N-prop-2-enylbenzenesulfonamide.
| Compound Name | 5-[4-[(5-chlorothiophen-2-yl)methyl]piperazine-1-carbonyl]-2-fluoro-N-prop-2-enylbenzenesulfonamide |
|---|---|
| PubChem CID | 55595841 |
| Molecular Formula | C19H21ClFN3O3S2 |
| Molecular Weight | 457.98 g/mol |
| Exact Mass | 457.07 |
| IUPAC Name | 5-[4-[(5-chlorothiophen-2-yl)methyl]piperazine-1-carbonyl]-2-fluoro-N-prop-2-enylbenzenesulfonamide |
| SMILES | C=CCNS(=O)(=O)c1cc(C(=O)N2CCN(Cc3ccc(Cl)s3)CC2)ccc1F |
| InChI | InChI=1S/C19H21ClFN3O3S2/c1-2-7-22-29(26,27)17-12-14(3-5-16(17)21)19(25)24-10-8-23(9-11-24)13-15-4-6-18(20)28-15/h2-6,12,22H,1,7-11,13H2 |
| InChIKey | YTUHCQGLYQYVNG-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.98 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|