C23H28FN3O5S — CID 55913569
5-[4-[(3,4-dimethoxyphenyl)methyl]piperazine-1-carbonyl]-2-fluoro-N-prop-2-enylbenzenesulfonamide (PubChem CID 55913569) has the molecular formula C23H28FN3O5S and a molecular weight of 477.56 g/mol. Its IUPAC name is 5-[4-[(3,4-dimethoxyphenyl)methyl]piperazine-1-carbonyl]-2-fluoro-N-prop-2-enylbenzenesulfonamide.
| Compound Name | 5-[4-[(3,4-dimethoxyphenyl)methyl]piperazine-1-carbonyl]-2-fluoro-N-prop-2-enylbenzenesulfonamide |
|---|---|
| PubChem CID | 55913569 |
| Molecular Formula | C23H28FN3O5S |
| Molecular Weight | 477.56 g/mol |
| Exact Mass | 477.17 |
| IUPAC Name | 5-[4-[(3,4-dimethoxyphenyl)methyl]piperazine-1-carbonyl]-2-fluoro-N-prop-2-enylbenzenesulfonamide |
| SMILES | C=CCNS(=O)(=O)c1cc(C(=O)N2CCN(Cc3ccc(OC)c(OC)c3)CC2)ccc1F |
| InChI | InChI=1S/C23H28FN3O5S/c1-4-9-25-33(29,30)22-15-18(6-7-19(22)24)23(28)27-12-10-26(11-13-27)16-17-5-8-20(31-2)21(14-17)32-3/h4-8,14-15,25H,1,9-13,16H2,2-3H3 |
| InChIKey | SCNDBJQETPRCTF-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.56 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|