C21H23ClFN3O3S — CID 34820558
4-[4-[(2-chloro-4-fluorophenyl)methyl]piperazine-1-carbonyl]-N-prop-2-enylbenzenesulfonamide (PubChem CID 34820558) has the molecular formula C21H23ClFN3O3S and a molecular weight of 451.95 g/mol. Its IUPAC name is 4-[4-[(2-chloro-4-fluorophenyl)methyl]piperazine-1-carbonyl]-N-prop-2-enylbenzenesulfonamide.
| Compound Name | 4-[4-[(2-chloro-4-fluorophenyl)methyl]piperazine-1-carbonyl]-N-prop-2-enylbenzenesulfonamide |
|---|---|
| PubChem CID | 34820558 |
| Molecular Formula | C21H23ClFN3O3S |
| Molecular Weight | 451.95 g/mol |
| Exact Mass | 451.11 |
| IUPAC Name | 4-[4-[(2-chloro-4-fluorophenyl)methyl]piperazine-1-carbonyl]-N-prop-2-enylbenzenesulfonamide |
| SMILES | C=CCNS(=O)(=O)c1ccc(C(=O)N2CCN(Cc3ccc(F)cc3Cl)CC2)cc1 |
| InChI | InChI=1S/C21H23ClFN3O3S/c1-2-9-24-30(28,29)19-7-4-16(5-8-19)21(27)26-12-10-25(11-13-26)15-17-3-6-18(23)14-20(17)22/h2-8,14,24H,1,9-13,15H2 |
| InChIKey | GYKIRCXNQLXLDP-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.95 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|