C21H24FN3O5S2 — CID 24552318
3-[4-(4-fluorophenyl)sulfonyl-1,4-diazepane-1-carbonyl]-N-prop-2-enylbenzenesulfonamide (PubChem CID 24552318) has the molecular formula C21H24FN3O5S2 and a molecular weight of 481.57 g/mol. Its IUPAC name is 3-[4-(4-fluorophenyl)sulfonyl-1,4-diazepane-1-carbonyl]-N-prop-2-enylbenzenesulfonamide.
| Compound Name | 3-[4-(4-fluorophenyl)sulfonyl-1,4-diazepane-1-carbonyl]-N-prop-2-enylbenzenesulfonamide |
|---|---|
| PubChem CID | 24552318 |
| Molecular Formula | C21H24FN3O5S2 |
| Molecular Weight | 481.57 g/mol |
| Exact Mass | 481.11 |
| IUPAC Name | 3-[4-(4-fluorophenyl)sulfonyl-1,4-diazepane-1-carbonyl]-N-prop-2-enylbenzenesulfonamide |
| SMILES | C=CCNS(=O)(=O)c1cccc(C(=O)N2CCCN(S(=O)(=O)c3ccc(F)cc3)CC2)c1 |
| InChI | InChI=1S/C21H24FN3O5S2/c1-2-11-23-31(27,28)20-6-3-5-17(16-20)21(26)24-12-4-13-25(15-14-24)32(29,30)19-9-7-18(22)8-10-19/h2-3,5-10,16,23H,1,4,11-15H2 |
| InChIKey | RKDDDSLIAYWVEK-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.57 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|