C16H19F3N2O4S — CID 97019761
3-[(3S)-3-hydroxy-3-(trifluoromethyl)piperidine-1-carbonyl]-N-prop-2-enylbenzenesulfonamide (PubChem CID 97019761) has the molecular formula C16H19F3N2O4S and a molecular weight of 392.40 g/mol. Its IUPAC name is 3-[(3S)-3-hydroxy-3-(trifluoromethyl)piperidine-1-carbonyl]-N-prop-2-enylbenzenesulfonamide.
| Compound Name | 3-[(3S)-3-hydroxy-3-(trifluoromethyl)piperidine-1-carbonyl]-N-prop-2-enylbenzenesulfonamide |
|---|---|
| PubChem CID | 97019761 |
| Molecular Formula | C16H19F3N2O4S |
| Molecular Weight | 392.40 g/mol |
| Exact Mass | 392.10 |
| IUPAC Name | 3-[(3S)-3-hydroxy-3-(trifluoromethyl)piperidine-1-carbonyl]-N-prop-2-enylbenzenesulfonamide |
| SMILES | C=CCNS(=O)(=O)c1cccc(C(=O)N2CCC[C@@](O)(C(F)(F)F)C2)c1 |
| InChI | InChI=1S/C16H19F3N2O4S/c1-2-8-20-26(24,25)13-6-3-5-12(10-13)14(22)21-9-4-7-15(23,11-21)16(17,18)19/h2-3,5-6,10,20,23H,1,4,7-9,11H2/t15-/m0/s1 |
| InChIKey | LVQSKYUNORMMBO-HNNXBMFYSA-N |
| XLogP | 1.68 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.40 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|