C16H16ClIN2OS — CID 27841614
[4-[(5-chlorothiophen-2-yl)methyl]piperazin-1-yl]-(3-iodophenyl)methanone (PubChem CID 27841614) has the molecular formula C16H16ClIN2OS and a molecular weight of 446.74 g/mol. Its IUPAC name is [4-[(5-chlorothiophen-2-yl)methyl]piperazin-1-yl]-(3-iodophenyl)methanone.
| Compound Name | [4-[(5-chlorothiophen-2-yl)methyl]piperazin-1-yl]-(3-iodophenyl)methanone |
|---|---|
| PubChem CID | 27841614 |
| Molecular Formula | C16H16ClIN2OS |
| Molecular Weight | 446.74 g/mol |
| Exact Mass | 445.97 |
| IUPAC Name | [4-[(5-chlorothiophen-2-yl)methyl]piperazin-1-yl]-(3-iodophenyl)methanone |
| SMILES | O=C(c1cccc(I)c1)N1CCN(Cc2ccc(Cl)s2)CC1 |
| InChI | InChI=1S/C16H16ClIN2OS/c17-15-5-4-14(22-15)11-19-6-8-20(9-7-19)16(21)12-2-1-3-13(18)10-12/h1-5,10H,6-9,11H2 |
| InChIKey | ILXHAUIERFPRSC-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.74 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|