C66H96N6O3S6 — CID 10582187
(13-benzyl-1,9-dithia-5,13-diazacyclohexadec-5-yl)-[3,5-bis(13-benzyl-1,9-dithia-5,13-diazacyclohexadecane-5-carbonyl)phenyl]methanone (PubChem CID 10582187) has the molecular formula C66H96N6O3S6 and a molecular weight of 1213.93 g/mol. Its IUPAC name is (13-benzyl-1,9-dithia-5,13-diazacyclohexadec-5-yl)-[3,5-bis(13-benzyl-1,9-dithia-5,13-diazacyclohexadecane-5-carbonyl)phenyl]methanone.
| Compound Name | (13-benzyl-1,9-dithia-5,13-diazacyclohexadec-5-yl)-[3,5-bis(13-benzyl-1,9-dithia-5,13-diazacyclohexadecane-5-carbonyl)phenyl]methanone |
|---|---|
| PubChem CID | 10582187 |
| Molecular Formula | C66H96N6O3S6 |
| Molecular Weight | 1213.93 g/mol |
| Exact Mass | 1212.59 |
| IUPAC Name | (13-benzyl-1,9-dithia-5,13-diazacyclohexadec-5-yl)-[3,5-bis(13-benzyl-1,9-dithia-5,13-diazacyclohexadecane-5-carbonyl)phenyl]methanone |
| SMILES | O=C(c1cc(C(=O)N2CCCSCCCN(Cc3ccccc3)CCCSCCC2)cc(C(=O)N2CCCSCCCN(Cc3ccccc3)CCCSCCC2)c1)N1CCCSCCCN(Cc2ccccc2)CCCSCCC1 |
| InChI | InChI=1S/C66H96N6O3S6/c73-64(70-34-16-46-76-40-10-28-67(29-11-41-77-47-17-35-70)55-58-22-4-1-5-23-58)61-52-62(65(74)71-36-18-48-78-42-12-30-68(31-13-43-79-49-19-37-71)56-59-24-6-2-7-25-59)54-63(53-61)66(75)72-38-20-50-80-44-14-32-69(33-15-45-81-51-21-39-72)57-60-26-8-3-9-27-60/h1-9,22-27,52-54H,10-21,28-51,55-57H2 |
| InChIKey | SOKFOMHLDOAEJQ-UHFFFAOYSA-N |
| XLogP | 13.64 |
| TPSA | 70.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 81 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1213.93 |
| LogP ≤ 5 | 13.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |