C13H14BrClN2O3S — CID 61115068
3-amino-N-[(5-bromofuran-2-yl)methyl]-5-chloro-N,4-dimethylbenzenesulfonamide (PubChem CID 61115068) has the molecular formula C13H14BrClN2O3S and a molecular weight of 393.69 g/mol. Its IUPAC name is 3-amino-N-[(5-bromofuran-2-yl)methyl]-5-chloro-N,4-dimethylbenzenesulfonamide.
| Compound Name | 3-amino-N-[(5-bromofuran-2-yl)methyl]-5-chloro-N,4-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 61115068 |
| Molecular Formula | C13H14BrClN2O3S |
| Molecular Weight | 393.69 g/mol |
| Exact Mass | 391.96 |
| IUPAC Name | 3-amino-N-[(5-bromofuran-2-yl)methyl]-5-chloro-N,4-dimethylbenzenesulfonamide |
| SMILES | Cc1c(N)cc(S(=O)(=O)N(C)Cc2ccc(Br)o2)cc1Cl |
| InChI | InChI=1S/C13H14BrClN2O3S/c1-8-11(15)5-10(6-12(8)16)21(18,19)17(2)7-9-3-4-13(14)20-9/h3-6H,7,16H2,1-2H3 |
| InChIKey | NFCBUZZHVYPISB-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 76.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.69 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|