C13H21ClN2O2S — CID 43274192
3-amino-N-butan-2-yl-5-chloro-N-ethyl-4-methylbenzenesulfonamide (PubChem CID 43274192) has the molecular formula C13H21ClN2O2S and a molecular weight of 304.84 g/mol. Its IUPAC name is 3-amino-N-butan-2-yl-5-chloro-N-ethyl-4-methylbenzenesulfonamide.
| Compound Name | 3-amino-N-butan-2-yl-5-chloro-N-ethyl-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 43274192 |
| Molecular Formula | C13H21ClN2O2S |
| Molecular Weight | 304.84 g/mol |
| Exact Mass | 304.10 |
| IUPAC Name | 3-amino-N-butan-2-yl-5-chloro-N-ethyl-4-methylbenzenesulfonamide |
| SMILES | CCC(C)N(CC)S(=O)(=O)c1cc(N)c(C)c(Cl)c1 |
| InChI | InChI=1S/C13H21ClN2O2S/c1-5-9(3)16(6-2)19(17,18)11-7-12(14)10(4)13(15)8-11/h7-9H,5-6,15H2,1-4H3 |
| InChIKey | BCYFQWNLARYSKR-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.84 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|