C13H18ClN3O2S — CID 61139914
3-amino-5-chloro-N-(2-cyanopropyl)-N-ethyl-4-methylbenzenesulfonamide (PubChem CID 61139914) has the molecular formula C13H18ClN3O2S and a molecular weight of 315.83 g/mol. Its IUPAC name is 3-amino-5-chloro-N-(2-cyanopropyl)-N-ethyl-4-methylbenzenesulfonamide.
| Compound Name | 3-amino-5-chloro-N-(2-cyanopropyl)-N-ethyl-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 61139914 |
| Molecular Formula | C13H18ClN3O2S |
| Molecular Weight | 315.83 g/mol |
| Exact Mass | 315.08 |
| IUPAC Name | 3-amino-5-chloro-N-(2-cyanopropyl)-N-ethyl-4-methylbenzenesulfonamide |
| SMILES | CCN(CC(C)C#N)S(=O)(=O)c1cc(N)c(C)c(Cl)c1 |
| InChI | InChI=1S/C13H18ClN3O2S/c1-4-17(8-9(2)7-15)20(18,19)11-5-12(14)10(3)13(16)6-11/h5-6,9H,4,8,16H2,1-3H3 |
| InChIKey | AVEYWJWHAYJDFV-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 87.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.83 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|