C12H14Cl2N2O2S — CID 47387966
2,5-dichloro-N-(2-cyanopropyl)-N-ethylbenzenesulfonamide (PubChem CID 47387966) has the molecular formula C12H14Cl2N2O2S and a molecular weight of 321.23 g/mol. Its IUPAC name is 2,5-dichloro-N-(2-cyanopropyl)-N-ethylbenzenesulfonamide.
| Compound Name | 2,5-dichloro-N-(2-cyanopropyl)-N-ethylbenzenesulfonamide |
|---|---|
| PubChem CID | 47387966 |
| Molecular Formula | C12H14Cl2N2O2S |
| Molecular Weight | 321.23 g/mol |
| Exact Mass | 320.02 |
| IUPAC Name | 2,5-dichloro-N-(2-cyanopropyl)-N-ethylbenzenesulfonamide |
| SMILES | CCN(CC(C)C#N)S(=O)(=O)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C12H14Cl2N2O2S/c1-3-16(8-9(2)7-15)19(17,18)12-6-10(13)4-5-11(12)14/h4-6,9H,3,8H2,1-2H3 |
| InChIKey | MFHFNPZCLFNFCT-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 61.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.23 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |